C22H23N3O — CID 146490200
N,N-diethyl-10-ethyliminobenzo[c]phenoxazin-3-amine (PubChem CID 146490200) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is N,N-diethyl-10-ethyliminobenzo[c]phenoxazin-3-amine.
| Compound Name | N,N-diethyl-10-ethyliminobenzo[c]phenoxazin-3-amine |
|---|---|
| PubChem CID | 146490200 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N,N-diethyl-10-ethyliminobenzo[c]phenoxazin-3-amine |
| SMILES | CC/N=c1\ccc2nc3ccc4cc(N(CC)CC)ccc4c3oc-2c1 |
| InChI | InChI=1S/C22H23N3O/c1-4-23-16-8-12-19-21(14-16)26-22-18-10-9-17(25(5-2)6-3)13-15(18)7-11-20(22)24-19/h7-14H,4-6H2,1-3H3/b23-16+ |
| InChIKey | LPIBTOKZYANOJD-XQNSMLJCSA-N |
| XLogP | 4.85 |
| TPSA | 41.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|