C24H21N3O — CID 142048774
N,N-diethyl-7-iminonaphtho[2,3-a]phenoxazin-3-amine (PubChem CID 142048774) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is N,N-diethyl-7-iminonaphtho[2,3-a]phenoxazin-3-amine.
| Compound Name | N,N-diethyl-7-iminonaphtho[2,3-a]phenoxazin-3-amine |
|---|---|
| PubChem CID | 142048774 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N,N-diethyl-7-iminonaphtho[2,3-a]phenoxazin-3-amine |
| SMILES | [H]/N=c1\cc2oc3cc(N(CC)CC)ccc3nc-2c2cc3ccccc3cc12 |
| InChI | InChI=1S/C24H21N3O/c1-3-27(4-2)17-9-10-21-22(13-17)28-23-14-20(25)18-11-15-7-5-6-8-16(15)12-19(18)24(23)26-21/h5-14,25H,3-4H2,1-2H3/b25-20+ |
| InChIKey | BTDPWGQCNMRRTJ-LKUDQCMESA-N |
| XLogP | 5.56 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|