C22H21N3O3 — CID 20688806
N-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-1-yl]acetamide (PubChem CID 20688806) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-1-yl]acetamide.
| Compound Name | N-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-1-yl]acetamide |
|---|---|
| PubChem CID | 20688806 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-1-yl]acetamide |
| SMILES | CCN(CC)c1ccc2nc3c4c(NC(C)=O)cccc4c(=O)cc-3oc2c1 |
| InChI | InChI=1S/C22H21N3O3/c1-4-25(5-2)14-9-10-16-19(11-14)28-20-12-18(27)15-7-6-8-17(23-13(3)26)21(15)22(20)24-16/h6-12H,4-5H2,1-3H3,(H,23,26) |
| InChIKey | MGEJRZWYVZKBQF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|