C30H24N4O4 — CID 101460651
4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]benzene-1,2-dicarboxamide (PubChem CID 101460651) has the molecular formula C30H24N4O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is 4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]benzene-1,2-dicarboxamide.
| Compound Name | 4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 101460651 |
| Molecular Formula | C30H24N4O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]benzene-1,2-dicarboxamide |
| SMILES | CCN(CC)c1ccc2nc3c4cc(C#Cc5ccc(C(N)=O)c(C(N)=O)c5)ccc4c(=O)cc-3oc2c1 |
| InChI | InChI=1S/C30H24N4O4/c1-3-34(4-2)19-9-12-24-26(15-19)38-27-16-25(35)20-10-7-17(13-22(20)28(27)33-24)5-6-18-8-11-21(29(31)36)23(14-18)30(32)37/h7-16H,3-4H2,1-2H3,(H2,31,36)(H2,32,37) |
| InChIKey | FXIZVFCCCVFQEL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|