C32H42N2O2 — CID 155293659
9-[bis(2-ethylhexyl)amino]benzo[a]phenoxazin-5-one (PubChem CID 155293659) has the molecular formula C32H42N2O2 and a molecular weight of 486.70 g/mol. Its IUPAC name is 9-[bis(2-ethylhexyl)amino]benzo[a]phenoxazin-5-one.
| Compound Name | 9-[bis(2-ethylhexyl)amino]benzo[a]phenoxazin-5-one |
|---|---|
| PubChem CID | 155293659 |
| Molecular Formula | C32H42N2O2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 9-[bis(2-ethylhexyl)amino]benzo[a]phenoxazin-5-one |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc2nc3c4ccccc4c(=O)cc-3oc2c1 |
| InChI | InChI=1S/C32H42N2O2/c1-5-9-13-23(7-3)21-34(22-24(8-4)14-10-6-2)25-17-18-28-30(19-25)36-31-20-29(35)26-15-11-12-16-27(26)32(31)33-28/h11-12,15-20,23-24H,5-10,13-14,21-22H2,1-4H3 |
| InChIKey | JNWKRYNKILKNBX-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|