C30H22N2O6 — CID 102469977
4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]phthalic acid (PubChem CID 102469977) has the molecular formula C30H22N2O6 and a molecular weight of 506.51 g/mol. Its IUPAC name is 4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]phthalic acid.
| Compound Name | 4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]phthalic acid |
|---|---|
| PubChem CID | 102469977 |
| Molecular Formula | C30H22N2O6 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 4-[2-[9-(diethylamino)-5-oxobenzo[a]phenoxazin-2-yl]ethynyl]phthalic acid |
| SMILES | CCN(CC)c1ccc2nc3c4cc(C#Cc5ccc(C(=O)O)c(C(=O)O)c5)ccc4c(=O)cc-3oc2c1 |
| InChI | InChI=1S/C30H22N2O6/c1-3-32(4-2)19-9-12-24-26(15-19)38-27-16-25(33)20-10-7-17(13-22(20)28(27)31-24)5-6-18-8-11-21(29(34)35)23(14-18)30(36)37/h7-16H,3-4H2,1-2H3,(H,34,35)(H,36,37) |
| InChIKey | CHIAHUYQBRRJGK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|