C27H23N3O3 — CID 18730904
9-(diethylamino)-5-oxo-N-phenylbenzo[a]phenoxazine-6-carboxamide (PubChem CID 18730904) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 9-(diethylamino)-5-oxo-N-phenylbenzo[a]phenoxazine-6-carboxamide.
| Compound Name | 9-(diethylamino)-5-oxo-N-phenylbenzo[a]phenoxazine-6-carboxamide |
|---|---|
| PubChem CID | 18730904 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 9-(diethylamino)-5-oxo-N-phenylbenzo[a]phenoxazine-6-carboxamide |
| SMILES | CCN(CC)c1ccc2nc3c4ccccc4c(=O)c(C(=O)Nc4ccccc4)c-3oc2c1 |
| InChI | InChI=1S/C27H23N3O3/c1-3-30(4-2)18-14-15-21-22(16-18)33-26-23(27(32)28-17-10-6-5-7-11-17)25(31)20-13-9-8-12-19(20)24(26)29-21/h5-16H,3-4H2,1-2H3,(H,28,32) |
| InChIKey | ZJNCHKMOMFNSJQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|