C38H33F5N4O4 — CID 21134638
N-[9-(diethylamino)-6-[3-(2,4-dimethylphenoxy)propylamino]-5-oxobenzo[a]phenoxazin-1-yl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 21134638) has the molecular formula C38H33F5N4O4 and a molecular weight of 704.70 g/mol. Its IUPAC name is N-[9-(diethylamino)-6-[3-(2,4-dimethylphenoxy)propylamino]-5-oxobenzo[a]phenoxazin-1-yl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[9-(diethylamino)-6-[3-(2,4-dimethylphenoxy)propylamino]-5-oxobenzo[a]phenoxazin-1-yl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 21134638 |
| Molecular Formula | C38H33F5N4O4 |
| Molecular Weight | 704.70 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | N-[9-(diethylamino)-6-[3-(2,4-dimethylphenoxy)propylamino]-5-oxobenzo[a]phenoxazin-1-yl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCN(CC)c1ccc2nc3c4c(NC(=O)c5c(F)c(F)c(F)c(F)c5F)cccc4c(=O)c(NCCCOc4ccc(C)cc4C)c-3oc2c1 |
| InChI | InChI=1S/C38H33F5N4O4/c1-5-47(6-2)21-12-13-23-26(18-21)51-37-34(45-23)27-22(36(48)35(37)44-15-8-16-50-25-14-11-19(3)17-20(25)4)9-7-10-24(27)46-38(49)28-29(39)31(41)33(43)32(42)30(28)40/h7,9-14,17-18,44H,5-6,8,15-16H2,1-4H3,(H,46,49) |
| InChIKey | JQCRZBVGFQWWRN-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.70 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|