C23H22F3N3O2S — CID 10434432
(1'S,4R,10'R)-5'-(2-pyridin-2-ylethynyl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 10434432) has the molecular formula C23H22F3N3O2S and a molecular weight of 461.51 g/mol. Its IUPAC name is (1'S,4R,10'R)-5'-(2-pyridin-2-ylethynyl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | (1'S,4R,10'R)-5'-(2-pyridin-2-ylethynyl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 10434432 |
| Molecular Formula | C23H22F3N3O2S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (1'S,4R,10'R)-5'-(2-pyridin-2-ylethynyl)-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | O=S1(=O)N[C@]2(CN1CC(F)(F)F)[C@@H]1CC[C@H]2Cc2cc(C#Cc3ccccn3)ccc2C1 |
| InChI | InChI=1S/C23H22F3N3O2S/c24-23(25,26)15-29-14-22(28-32(29,30)31)19-7-8-20(22)13-18-11-16(4-6-17(18)12-19)5-9-21-3-1-2-10-27-21/h1-4,6,10-11,19-20,28H,7-8,12-15H2/t19-,20+,22-/m1/s1 |
| InChIKey | VRZHVYYWJNNMJC-RZUBCFFCSA-N |
| XLogP | 3.06 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|