C17H21F3N4O3S — CID 162134747
(1'R,4R,10'S)-N'-hydroxy-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboximidamide (PubChem CID 162134747) has the molecular formula C17H21F3N4O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is (1'R,4R,10'S)-N'-hydroxy-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboximidamide.
| Compound Name | (1'R,4R,10'S)-N'-hydroxy-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboximidamide |
|---|---|
| PubChem CID | 162134747 |
| Molecular Formula | C17H21F3N4O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (1'R,4R,10'S)-N'-hydroxy-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboximidamide |
| SMILES | N/C(=N/O)c1ccc2c(c1)C[C@H]1CC[C@@H](C2)[C@]12CN(CC(F)(F)F)S(=O)(=O)N2 |
| InChI | InChI=1S/C17H21F3N4O3S/c18-17(19,20)9-24-8-16(23-28(24,26)27)13-3-4-14(16)7-12-5-11(15(21)22-25)2-1-10(12)6-13/h1-2,5,13-14,23,25H,3-4,6-9H2,(H2,21,22)/t13-,14+,16+/m0/s1 |
| InChIKey | ZJCXAAKRRFHOML-SQWLQELKSA-N |
| XLogP | 1.36 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|