C23H34N2O2S — CID 58742124
(1'S,4R,10'R)-5'-tert-butyl-2-cyclopentylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide (PubChem CID 58742124) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is (1'S,4R,10'R)-5'-tert-butyl-2-cyclopentylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide.
| Compound Name | (1'S,4R,10'R)-5'-tert-butyl-2-cyclopentylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
|---|---|
| PubChem CID | 58742124 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (1'S,4R,10'R)-5'-tert-butyl-2-cyclopentylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene] 1,1-dioxide |
| SMILES | CC(C)(C)c1ccc2c(c1)C[C@@H]1CC[C@H](C2)[C@]12CN(C1CCCC1)S(=O)(=O)N2 |
| InChI | InChI=1S/C23H34N2O2S/c1-22(2,3)18-9-8-16-12-19-10-11-20(14-17(16)13-18)23(19)15-25(28(26,27)24-23)21-6-4-5-7-21/h8-9,13,19-21,24H,4-7,10-12,14-15H2,1-3H3/t19-,20+,23-/m1/s1 |
| InChIKey | STTREBAIFRJGLD-ZRCGQRJVSA-N |
| XLogP | 3.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |