C25H29F3N2O3 — CID 10434481
ethyl 2-[benzyl-[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate (PubChem CID 10434481) has the molecular formula C25H29F3N2O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is ethyl 2-[benzyl-[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate.
| Compound Name | ethyl 2-[benzyl-[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10434481 |
| Molecular Formula | C25H29F3N2O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | ethyl 2-[benzyl-[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate |
| SMILES | CCCCN1CC1(C(=O)OCC)C(=O)N(Cc1ccccc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H29F3N2O3/c1-3-5-15-30-18-24(30,23(32)33-4-2)22(31)29(16-19-9-7-6-8-10-19)17-20-11-13-21(14-12-20)25(26,27)28/h6-14H,3-5,15-18H2,1-2H3 |
| InChIKey | UWXHHLQIFDLEIP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|