C26H28F6N2O3 — CID 11756769
ethyl 2-[bis[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate (PubChem CID 11756769) has the molecular formula C26H28F6N2O3 and a molecular weight of 530.51 g/mol. Its IUPAC name is ethyl 2-[bis[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate.
| Compound Name | ethyl 2-[bis[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11756769 |
| Molecular Formula | C26H28F6N2O3 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | ethyl 2-[bis[[4-(trifluoromethyl)phenyl]methyl]carbamoyl]-1-butylaziridine-2-carboxylate |
| SMILES | CCCCN1CC1(C(=O)OCC)C(=O)N(Cc1ccc(C(F)(F)F)cc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H28F6N2O3/c1-3-5-14-34-17-24(34,23(36)37-4-2)22(35)33(15-18-6-10-20(11-7-18)25(27,28)29)16-19-8-12-21(13-9-19)26(30,31)32/h6-13H,3-5,14-17H2,1-2H3 |
| InChIKey | KTIMNMPYCTYSOP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|