C3H5N5 — CID 10435
1,3,5-triazine-2,4-diamine (PubChem CID 10435) has the molecular formula C3H5N5 and a molecular weight of 111.11 g/mol. Its IUPAC name is 1,3,5-triazine-2,4-diamine.
| Compound Name | 1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10435 |
| Molecular Formula | C3H5N5 |
| Molecular Weight | 111.11 g/mol |
| Exact Mass | 111.05 |
| IUPAC Name | 1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(N)n1 |
| InChI | InChI=1S/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
| InChIKey | VZXTWGWHSMCWGA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.11 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |