C4H6N6 — CID 23514485
6-(methylideneamino)-1,3,5-triazine-2,4-diamine (PubChem CID 23514485) has the molecular formula C4H6N6 and a molecular weight of 138.13 g/mol. Its IUPAC name is 6-(methylideneamino)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(methylideneamino)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23514485 |
| Molecular Formula | C4H6N6 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 6-(methylideneamino)-1,3,5-triazine-2,4-diamine |
| SMILES | C=Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H6N6/c1-7-4-9-2(5)8-3(6)10-4/h1H2,(H4,5,6,8,9,10) |
| InChIKey | DZBIMLCMMYGJFY-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|