C29H34O6 — CID 10435207
[(1S,4S,5S,6R,9S,10R,12R,14R)-6-acetyloxy-5-hydroxy-3,7,11,11,14-pentamethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] benzoate (PubChem CID 10435207) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-6-acetyloxy-5-hydroxy-3,7,11,11,14-pentamethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] benzoate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-6-acetyloxy-5-hydroxy-3,7,11,11,14-pentamethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] benzoate |
|---|---|
| PubChem CID | 10435207 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-6-acetyloxy-5-hydroxy-3,7,11,11,14-pentamethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] benzoate |
| SMILES | CC(=O)O[C@@H]1C(C)=C[C@@H]2C(=O)[C@]3(C=C(C)[C@H](OC(=O)c4ccccc4)[C@@]13O)[C@H](C)C[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C29H34O6/c1-15-12-20-22-21(27(22,5)6)13-17(3)28(23(20)31)14-16(2)25(29(28,33)24(15)34-18(4)30)35-26(32)19-10-8-7-9-11-19/h7-12,14,17,20-22,24-25,33H,13H2,1-6H3/t17-,20+,21-,22+,24-,25+,28+,29+/m1/s1 |
| InChIKey | FXISXCYGAICATP-IMNYCCSCSA-N |
| XLogP | 4.28 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|