C27H36N2O6 — CID 10435447
6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxohexanamide (PubChem CID 10435447) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxohexanamide.
| Compound Name | 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxohexanamide |
|---|---|
| PubChem CID | 10435447 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-6-oxohexanamide |
| SMILES | COc1ccc(CCNC(=O)CCCCC(=O)N2CCc3cc(OC)c(OC)cc3C2)cc1OC |
| InChI | InChI=1S/C27H36N2O6/c1-32-22-10-9-19(15-23(22)33-2)11-13-28-26(30)7-5-6-8-27(31)29-14-12-20-16-24(34-3)25(35-4)17-21(20)18-29/h9-10,15-17H,5-8,11-14,18H2,1-4H3,(H,28,30) |
| InChIKey | RIBGMILPPGFZAV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|