About Orcinol
Orcinol (PubChem CID 10436) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 5-methylbenzene-1,3-diol.
Molecular Properties
| Compound Name | Orcinol |
| PubChem CID | 10436 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 5-methylbenzene-1,3-diol |
| SMILES | CC1=CC(=CC(=C1)O)O |
| InChI | InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3 |
| InChIKey | OIPPWFOQEKKFEE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 82 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Orcinol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Orcinol?
The IUPAC name of Orcinol (CID 10436) is 5-methylbenzene-1,3-diol.
What is the SMILES notation for Orcinol?
The canonical SMILES for Orcinol is CC1=CC(=CC(=C1)O)O.
What is the InChIKey of Orcinol?
The InChIKey is OIPPWFOQEKKFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3.
What are the key properties of Orcinol?
Orcinol has a molecular weight of 124.14 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Orcinol is sourced from PubChem (CID 10436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).