C48H54O4 — CID 10439670
2-[3-oxo-2-[2,4,6-tri(propan-2-yl)phenyl]inden-1-yl]oxy-2-[2,4,6-tri(propan-2-yl)phenyl]indene-1,3-dione (PubChem CID 10439670) has the molecular formula C48H54O4 and a molecular weight of 694.96 g/mol. Its IUPAC name is 2-[3-oxo-2-[2,4,6-tri(propan-2-yl)phenyl]inden-1-yl]oxy-2-[2,4,6-tri(propan-2-yl)phenyl]indene-1,3-dione.
| Compound Name | 2-[3-oxo-2-[2,4,6-tri(propan-2-yl)phenyl]inden-1-yl]oxy-2-[2,4,6-tri(propan-2-yl)phenyl]indene-1,3-dione |
|---|---|
| PubChem CID | 10439670 |
| Molecular Formula | C48H54O4 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.40 |
| IUPAC Name | 2-[3-oxo-2-[2,4,6-tri(propan-2-yl)phenyl]inden-1-yl]oxy-2-[2,4,6-tri(propan-2-yl)phenyl]indene-1,3-dione |
| SMILES | CC(C)c1cc(C(C)C)c(C2=C(OC3(c4c(C(C)C)cc(C(C)C)cc4C(C)C)C(=O)c4ccccc4C3=O)c3ccccc3C2=O)c(C(C)C)c1 |
| InChI | InChI=1S/C48H54O4/c1-25(2)31-21-37(27(5)6)41(38(22-31)28(7)8)42-44(49)33-17-13-14-18-34(33)45(42)52-48(46(50)35-19-15-16-20-36(35)47(48)51)43-39(29(9)10)23-32(26(3)4)24-40(43)30(11)12/h13-30H,1-12H3 |
| InChIKey | YIKMQALSKSMTPD-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|