C37H31F5N2O7 — CID 10439774
(2,3,4,5,6-pentafluorophenyl) 3-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]methyl]benzoate (PubChem CID 10439774) has the molecular formula C37H31F5N2O7 and a molecular weight of 710.65 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]methyl]benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 10439774 |
| Molecular Formula | C37H31F5N2O7 |
| Molecular Weight | 710.65 g/mol |
| Exact Mass | 710.21 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCc1cccc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C37H31F5N2O7/c1-37(2,3)51-27(45)16-26(44-36(48)49-18-25-23-13-6-4-11-21(23)22-12-5-7-14-24(22)25)34(46)43-17-19-9-8-10-20(15-19)35(47)50-33-31(41)29(39)28(38)30(40)32(33)42/h4-15,25-26H,16-18H2,1-3H3,(H,43,46)(H,44,48)/t26-/m0/s1 |
| InChIKey | LTOOGSATUWPMHK-SANMLTNESA-N |
| XLogP | 6.86 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|