C10H12O4 — CID 10442660
ethyl 3-hydroxy-3-methyl-6-oxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 10442660) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-methyl-6-oxocyclohexa-1,4-diene-1-carboxylate.
| Compound Name | ethyl 3-hydroxy-3-methyl-6-oxocyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 10442660 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | ethyl 3-hydroxy-3-methyl-6-oxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(C)(O)C=CC1=O |
| InChI | InChI=1S/C10H12O4/c1-3-14-9(12)7-6-10(2,13)5-4-8(7)11/h4-6,13H,3H2,1-2H3 |
| InChIKey | XALQNFLWYKKABK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|