C8H10N2O4S — CID 10443832
(1S,2R,6R,7R)-9-amino-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione (PubChem CID 10443832) has the molecular formula C8H10N2O4S and a molecular weight of 230.25 g/mol. Its IUPAC name is (1S,2R,6R,7R)-9-amino-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione.
| Compound Name | (1S,2R,6R,7R)-9-amino-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
|---|---|
| PubChem CID | 10443832 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (1S,2R,6R,7R)-9-amino-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
| SMILES | NN1C(=O)[C@@H]2[C@H]3CCS(=O)(=O)[C@H]3[C@@H]2C1=O |
| InChI | InChI=1S/C8H10N2O4S/c9-10-7(11)4-3-1-2-15(13,14)6(3)5(4)8(10)12/h3-6H,1-2,9H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | URUIGLOTEDIVHV-KVTDHHQDSA-N |
| XLogP | -1.72 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|