C9H11NO4S — CID 10242915
(1S,2R,6R,7R)-9-methyl-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione (PubChem CID 10242915) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is (1S,2R,6R,7R)-9-methyl-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione.
| Compound Name | (1S,2R,6R,7R)-9-methyl-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
|---|---|
| PubChem CID | 10242915 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | (1S,2R,6R,7R)-9-methyl-3,3-dioxo-3λ6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
| SMILES | CN1C(=O)[C@@H]2[C@H]3CCS(=O)(=O)[C@H]3[C@@H]2C1=O |
| InChI | InChI=1S/C9H11NO4S/c1-10-8(11)5-4-2-3-15(13,14)7(4)6(5)9(10)12/h4-7H,2-3H2,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | KUWSUNUNVPAKEW-DBRKOABJSA-N |
| XLogP | -0.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|