C16H24O — CID 10443962
(4Z)-4-butyl-5-ethyl-8-methylnona-4,6,7-trien-2-yn-1-ol (PubChem CID 10443962) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (4Z)-4-butyl-5-ethyl-8-methylnona-4,6,7-trien-2-yn-1-ol.
| Compound Name | (4Z)-4-butyl-5-ethyl-8-methylnona-4,6,7-trien-2-yn-1-ol |
|---|---|
| PubChem CID | 10443962 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (4Z)-4-butyl-5-ethyl-8-methylnona-4,6,7-trien-2-yn-1-ol |
| SMILES | CCCC/C(C#CCO)=C(/C=C=C(C)C)CC |
| InChI | InChI=1S/C16H24O/c1-5-7-9-16(10-8-13-17)15(6-2)12-11-14(3)4/h12,17H,5-7,9,13H2,1-4H3/b16-15- |
| InChIKey | NVMNQGCSBFIROL-NXVVXOECSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|