C19H25NO2 — CID 10447479
(3S,7aR)-7a-heptyl-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 10447479) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (3S,7aR)-7a-heptyl-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (3S,7aR)-7a-heptyl-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10447479 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (3S,7aR)-7a-heptyl-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | CCCCCCC[C@@]12C=CC(=O)N1[C@@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C19H25NO2/c1-2-3-4-5-9-13-19-14-12-18(21)20(19)17(15-22-19)16-10-7-6-8-11-16/h6-8,10-12,14,17H,2-5,9,13,15H2,1H3/t17-,19-/m1/s1 |
| InChIKey | APCFGCLBTLUQFB-IEBWSBKVSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|