C16H25BN2O3 — CID 10447730
N-[2-(diethylamino)ethyl]-4-(1,3,2-dioxaborinan-2-yl)benzamide (PubChem CID 10447730) has the molecular formula C16H25BN2O3 and a molecular weight of 304.20 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-(1,3,2-dioxaborinan-2-yl)benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-(1,3,2-dioxaborinan-2-yl)benzamide |
|---|---|
| PubChem CID | 10447730 |
| Molecular Formula | C16H25BN2O3 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-(1,3,2-dioxaborinan-2-yl)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(B2OCCCO2)cc1 |
| InChI | InChI=1S/C16H25BN2O3/c1-3-19(4-2)11-10-18-16(20)14-6-8-15(9-7-14)17-21-12-5-13-22-17/h6-9H,3-5,10-13H2,1-2H3,(H,18,20) |
| InChIKey | IYQXVZARNKZJSB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|