C16H14ClN4O+ — CID 10448319
4-(2-chloroethyl)-17-methyl-2,10,17-triaza-4-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one (PubChem CID 10448319) has the molecular formula C16H14ClN4O+ and a molecular weight of 313.77 g/mol. Its IUPAC name is 4-(2-chloroethyl)-17-methyl-2,10,17-triaza-4-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one.
| Compound Name | 4-(2-chloroethyl)-17-methyl-2,10,17-triaza-4-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one |
|---|---|
| PubChem CID | 10448319 |
| Molecular Formula | C16H14ClN4O+ |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-(2-chloroethyl)-17-methyl-2,10,17-triaza-4-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaen-9-one |
| SMILES | Cn1c2ccccc2n2c(=O)c3ccc[n+](CCCl)c3nc12 |
| InChI | InChI=1S/C16H14ClN4O/c1-19-12-6-2-3-7-13(12)21-15(22)11-5-4-9-20(10-8-17)14(11)18-16(19)21/h2-7,9H,8,10H2,1H3/q+1 |
| InChIKey | QTBZHBJZWYIISW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|