C17H29N7 — CID 10449392
N,2-dimethyl-8-[5-(4-methylpiperazin-1-yl)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 10449392) has the molecular formula C17H29N7 and a molecular weight of 331.47 g/mol. Its IUPAC name is N,2-dimethyl-8-[5-(4-methylpiperazin-1-yl)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N,2-dimethyl-8-[5-(4-methylpiperazin-1-yl)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 10449392 |
| Molecular Formula | C17H29N7 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | N,2-dimethyl-8-[5-(4-methylpiperazin-1-yl)pentyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CNc1nc(C)nc2c(CCCCCN3CCN(C)CC3)cnn12 |
| InChI | InChI=1S/C17H29N7/c1-14-20-16-15(13-19-24(16)17(18-2)21-14)7-5-4-6-8-23-11-9-22(3)10-12-23/h13H,4-12H2,1-3H3,(H,18,20,21) |
| InChIKey | HQKFKBIUDSMNTC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|