C18H25NO3S — CID 10449631
1-[(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]piperidin-4-one (PubChem CID 10449631) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]piperidin-4-one.
| Compound Name | 1-[(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]piperidin-4-one |
|---|---|
| PubChem CID | 10449631 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]piperidin-4-one |
| SMILES | O=C1CCN([C@@H]2CCCC[C@@H]2CS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25NO3S/c20-16-10-12-19(13-11-16)18-9-5-4-6-15(18)14-23(21,22)17-7-2-1-3-8-17/h1-3,7-8,15,18H,4-6,9-14H2/t15-,18-/m1/s1 |
| InChIKey | SZKCZQGOWOOVSU-CRAIPNDOSA-N |
| XLogP | 2.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |