C16H23NO3S — CID 135050366
1-[(3S,4S)-4-(benzenesulfonyl)-1-butan-2-ylpyrrolidin-3-yl]ethanone (PubChem CID 135050366) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 1-[(3S,4S)-4-(benzenesulfonyl)-1-butan-2-ylpyrrolidin-3-yl]ethanone.
| Compound Name | 1-[(3S,4S)-4-(benzenesulfonyl)-1-butan-2-ylpyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 135050366 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-[(3S,4S)-4-(benzenesulfonyl)-1-butan-2-ylpyrrolidin-3-yl]ethanone |
| SMILES | CCC(C)N1C[C@@H](S(=O)(=O)c2ccccc2)[C@H](C(C)=O)C1 |
| InChI | InChI=1S/C16H23NO3S/c1-4-12(2)17-10-15(13(3)18)16(11-17)21(19,20)14-8-6-5-7-9-14/h5-9,12,15-16H,4,10-11H2,1-3H3/t12?,15-,16+/m0/s1 |
| InChIKey | LTVOKDUMSLRTCF-FFPFEORLSA-N |
| XLogP | 2.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |