C14H15Cl2FO2S — CID 10449714
(3S)-1,1-dichloro-1-fluoro-3-[(R)-(4-methylphenyl)sulfinyl]hept-6-en-2-one (PubChem CID 10449714) has the molecular formula C14H15Cl2FO2S and a molecular weight of 337.24 g/mol. Its IUPAC name is (3S)-1,1-dichloro-1-fluoro-3-[(R)-(4-methylphenyl)sulfinyl]hept-6-en-2-one.
| Compound Name | (3S)-1,1-dichloro-1-fluoro-3-[(R)-(4-methylphenyl)sulfinyl]hept-6-en-2-one |
|---|---|
| PubChem CID | 10449714 |
| Molecular Formula | C14H15Cl2FO2S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | (3S)-1,1-dichloro-1-fluoro-3-[(R)-(4-methylphenyl)sulfinyl]hept-6-en-2-one |
| SMILES | C=CCC[C@@H](C(=O)C(F)(Cl)Cl)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H15Cl2FO2S/c1-3-4-5-12(13(18)14(15,16)17)20(19)11-8-6-10(2)7-9-11/h3,6-9,12H,1,4-5H2,2H3/t12-,20-/m0/s1 |
| InChIKey | ULCJZMVDLUCQNH-YUNKPMOVSA-N |
| XLogP | 4.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|