C19H20O6 — CID 10450173
(1S,2R,3R,19S)-3,19-dimethyl-8,14-dioxatetracyclo[13.4.0.02,7.03,19]nonadeca-6,15-diene-4,5,17,18-tetrone (PubChem CID 10450173) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (1S,2R,3R,19S)-3,19-dimethyl-8,14-dioxatetracyclo[13.4.0.02,7.03,19]nonadeca-6,15-diene-4,5,17,18-tetrone.
| Compound Name | (1S,2R,3R,19S)-3,19-dimethyl-8,14-dioxatetracyclo[13.4.0.02,7.03,19]nonadeca-6,15-diene-4,5,17,18-tetrone |
|---|---|
| PubChem CID | 10450173 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (1S,2R,3R,19S)-3,19-dimethyl-8,14-dioxatetracyclo[13.4.0.02,7.03,19]nonadeca-6,15-diene-4,5,17,18-tetrone |
| SMILES | C[C@@]12C(=O)C(=O)C=C3OCCCCCOC4=CC(=O)C(=O)[C@]1(C)[C@H]4[C@H]32 |
| InChI | InChI=1S/C19H20O6/c1-18-14-12(8-10(20)16(18)22)24-6-4-3-5-7-25-13-9-11(21)17(23)19(18,2)15(13)14/h8-9,14-15H,3-7H2,1-2H3/t14-,15+,18+,19- |
| InChIKey | ZWLDENLJCBGPTG-DJDHSFSDSA-N |
| XLogP | 1.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|