C18H18O6 — CID 10019514
(1R,2S,3S,18R)-3,18-dimethyl-8,13-dioxatetracyclo[12.4.0.02,7.03,18]octadeca-6,14-diene-4,5,16,17-tetrone (PubChem CID 10019514) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (1R,2S,3S,18R)-3,18-dimethyl-8,13-dioxatetracyclo[12.4.0.02,7.03,18]octadeca-6,14-diene-4,5,16,17-tetrone.
| Compound Name | (1R,2S,3S,18R)-3,18-dimethyl-8,13-dioxatetracyclo[12.4.0.02,7.03,18]octadeca-6,14-diene-4,5,16,17-tetrone |
|---|---|
| PubChem CID | 10019514 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (1R,2S,3S,18R)-3,18-dimethyl-8,13-dioxatetracyclo[12.4.0.02,7.03,18]octadeca-6,14-diene-4,5,16,17-tetrone |
| SMILES | C[C@@]12C(=O)C(=O)C=C3OCCCCOC4=CC(=O)C(=O)[C@]1(C)[C@H]4[C@H]32 |
| InChI | InChI=1S/C18H18O6/c1-17-13-11(7-9(19)15(17)21)23-5-3-4-6-24-12-8-10(20)16(22)18(17,2)14(12)13/h7-8,13-14H,3-6H2,1-2H3/t13-,14+,17+,18- |
| InChIKey | IPNXXXHCMHDLOW-PURYLZLUSA-N |
| XLogP | 1.14 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|