C20H22O6 — CID 10361031
(1R,2R,3R,20R)-3,20-dimethyl-8,15-dioxatetracyclo[14.4.0.02,7.03,20]icosa-6,16-diene-4,5,18,19-tetrone (PubChem CID 10361031) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (1R,2R,3R,20R)-3,20-dimethyl-8,15-dioxatetracyclo[14.4.0.02,7.03,20]icosa-6,16-diene-4,5,18,19-tetrone.
| Compound Name | (1R,2R,3R,20R)-3,20-dimethyl-8,15-dioxatetracyclo[14.4.0.02,7.03,20]icosa-6,16-diene-4,5,18,19-tetrone |
|---|---|
| PubChem CID | 10361031 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (1R,2R,3R,20R)-3,20-dimethyl-8,15-dioxatetracyclo[14.4.0.02,7.03,20]icosa-6,16-diene-4,5,18,19-tetrone |
| SMILES | C[C@]12C(=O)C(=O)C=C3OCCCCCCOC4=CC(=O)C(=O)[C@]1(C)[C@H]4[C@@H]32 |
| InChI | InChI=1S/C20H22O6/c1-19-15-13(9-11(21)17(19)23)25-7-5-3-4-6-8-26-14-10-12(22)18(24)20(19,2)16(14)15/h9-10,15-16H,3-8H2,1-2H3/t15-,16-,19+,20+/m1/s1 |
| InChIKey | SGOCHZIUVYUVKP-YKCBXCCJSA-N |
| XLogP | 1.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|