C12H18BrN3O — CID 104506749
2-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]cyclohexan-1-ol (PubChem CID 104506749) has the molecular formula C12H18BrN3O and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]cyclohexan-1-ol.
| Compound Name | 2-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 104506749 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]cyclohexan-1-ol |
| SMILES | Cc1c(N)cnc(NC2CCCCC2O)c1Br |
| InChI | InChI=1S/C12H18BrN3O/c1-7-8(14)6-15-12(11(7)13)16-9-4-2-3-5-10(9)17/h6,9-10,17H,2-5,14H2,1H3,(H,15,16) |
| InChIKey | BHTOGQZKJAVFAO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |