About N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine
N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine (PubChem CID 104513657) has the molecular formula C12H20ClN3
and a molecular weight of 241.77 g/mol. Its IUPAC name is N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine.
Molecular Properties
| Compound Name | N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine |
| PubChem CID | 104513657 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine |
| SMILES | CC(N(C)Cc1ccc(Cl)nn1)C(C)(C)C |
| InChI | InChI=1S/C12H20ClN3/c1-9(12(2,3)4)16(5)8-10-6-7-11(13)15-14-10/h6-7,9H,8H2,1-5H3 |
| InChIKey | ZLAOKCCOYNFHCK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine?
The IUPAC name of N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine (CID 104513657) is N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine.
What is the SMILES notation for N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine?
The canonical SMILES for N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine is CC(N(C)Cc1ccc(Cl)nn1)C(C)(C)C.
What is the InChIKey of N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine?
The InChIKey is ZLAOKCCOYNFHCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN3/c1-9(12(2,3)4)16(5)8-10-6-7-11(13)15-14-10/h6-7,9H,8H2,1-5H3.
What are the key properties of N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine?
N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine has a molecular weight of 241.77 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-chloropyridazin-3-yl)methyl]-N,3,3-trimethylbutan-2-amine is sourced from PubChem (CID 104513657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).