C12H12N2O5S — CID 104517998
6-(2-methylsulfonylpropanoyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 104517998) has the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. Its IUPAC name is 6-(2-methylsulfonylpropanoyl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(2-methylsulfonylpropanoyl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 104517998 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 6-(2-methylsulfonylpropanoyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CC(C(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)S(C)(=O)=O |
| InChI | InChI=1S/C12H12N2O5S/c1-6(20(2,18)19)10(15)7-3-4-8-9(5-7)14-12(17)11(16)13-8/h3-6H,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | SLQRULPZRISIFN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|