C11H12N2O3 — CID 146342056
6-propan-2-yloxy-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 146342056) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 6-propan-2-yloxy-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-propan-2-yloxy-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 146342056 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 6-propan-2-yloxy-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CC(C)Oc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H12N2O3/c1-6(2)16-7-3-4-8-9(5-7)13-11(15)10(14)12-8/h3-6H,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | LSFDEXKKAUMWQL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|