C10H12N2OS — CID 18966959
5-propan-2-yloxy-1,3-dihydrobenzimidazole-2-thione (PubChem CID 18966959) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 5-propan-2-yloxy-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5-propan-2-yloxy-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 18966959 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-propan-2-yloxy-1,3-dihydrobenzimidazole-2-thione |
| SMILES | CC(C)Oc1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C10H12N2OS/c1-6(2)13-7-3-4-8-9(5-7)12-10(14)11-8/h3-6H,1-2H3,(H2,11,12,14) |
| InChIKey | KDIKVVGTZRPPGN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|