About molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione
molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione (PubChem CID 153334557) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 153334557 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione |
| SMILES | CC(C)c1ccc2[nH]c(=S)[nH]c2c1.[H][H].[H][H] |
| InChI | InChI=1S/C10H12N2S.2H2/c1-6(2)7-3-4-8-9(5-7)12-10(13)11-8;;/h3-6H,1-2H3,(H2,11,12,13);2*1H |
| InChIKey | LPKXLAJCYIHDTA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione (CID 153334557) is molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione is CC(C)c1ccc2[nH]c(=S)[nH]c2c1.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is LPKXLAJCYIHDTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S.2H2/c1-6(2)7-3-4-8-9(5-7)12-10(13)11-8;;/h3-6H,1-2H3,(H2,11,12,13);2*1H.
What are the key properties of molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione?
molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 196.32 g/mol, XLogP of 3.84, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;5-propan-2-yl-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 153334557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).