C11H11NOS2 — CID 54452727
6-propan-2-yl-1H-3,1-benzoxazine-2,4-dithione (PubChem CID 54452727) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-propan-2-yl-1H-3,1-benzoxazine-2,4-dithione.
| Compound Name | 6-propan-2-yl-1H-3,1-benzoxazine-2,4-dithione |
|---|---|
| PubChem CID | 54452727 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 6-propan-2-yl-1H-3,1-benzoxazine-2,4-dithione |
| SMILES | CC(C)c1ccc2[nH]c(=S)oc(=S)c2c1 |
| InChI | InChI=1S/C11H11NOS2/c1-6(2)7-3-4-9-8(5-7)10(14)13-11(15)12-9/h3-6H,1-2H3,(H,12,15) |
| InChIKey | WWBLKJDFXAYSQB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|