C13H23NO2S — CID 104518814
1-(cyclohexen-1-yl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine (PubChem CID 104518814) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine.
| Compound Name | 1-(cyclohexen-1-yl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 104518814 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(cyclohexen-1-yl)-1-(1,1-dioxothian-2-yl)-N-methylmethanamine |
| SMILES | CNC(C1=CCCCC1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H23NO2S/c1-14-13(11-7-3-2-4-8-11)12-9-5-6-10-17(12,15)16/h7,12-14H,2-6,8-10H2,1H3 |
| InChIKey | XJCXDIJRYXVEPR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|