C14H18N2O2S — CID 104520336
2-(6-ethyl-1H-benzimidazol-2-yl)thiane 1,1-dioxide (PubChem CID 104520336) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-(6-ethyl-1H-benzimidazol-2-yl)thiane 1,1-dioxide.
| Compound Name | 2-(6-ethyl-1H-benzimidazol-2-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104520336 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(6-ethyl-1H-benzimidazol-2-yl)thiane 1,1-dioxide |
| SMILES | CCc1ccc2nc(C3CCCCS3(=O)=O)[nH]c2c1 |
| InChI | InChI=1S/C14H18N2O2S/c1-2-10-6-7-11-12(9-10)16-14(15-11)13-5-3-4-8-19(13,17)18/h6-7,9,13H,2-5,8H2,1H3,(H,15,16) |
| InChIKey | VOGSLGXPRSHQEW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |