C11H20ClNO4S — CID 104522258
N-(2-chloro-3-methoxypropyl)-N-methyl-1,1-dioxothiane-2-carboxamide (PubChem CID 104522258) has the molecular formula C11H20ClNO4S and a molecular weight of 297.80 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N-methyl-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-N-methyl-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104522258 |
| Molecular Formula | C11H20ClNO4S |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N-methyl-1,1-dioxothiane-2-carboxamide |
| SMILES | COCC(Cl)CN(C)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H20ClNO4S/c1-13(7-9(12)8-17-2)11(14)10-5-3-4-6-18(10,15)16/h9-10H,3-8H2,1-2H3 |
| InChIKey | MWIUFWXDIIWYBP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|