C11H21N3O3S2 — CID 104522764
N-(2-methoxyethyl)-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 104522764) has the molecular formula C11H21N3O3S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 104522764 |
| Molecular Formula | C11H21N3O3S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(2-methoxyethyl)-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | COCCNCCCc1nnc(C(C)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C11H21N3O3S2/c1-9(19(3,15)16)11-14-13-10(18-11)5-4-6-12-7-8-17-2/h9,12H,4-8H2,1-3H3 |
| InChIKey | SKQZMNZXZQOGDN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|