C10H19N3O2S2 — CID 113422543
N-ethyl-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine (PubChem CID 113422543) has the molecular formula C10H19N3O2S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is N-ethyl-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine.
| Compound Name | N-ethyl-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 113422543 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-ethyl-3-[5-(1-methylsulfonylethyl)-1,3,4-thiadiazol-2-yl]propan-1-amine |
| SMILES | CCNCCCc1nnc(C(C)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C10H19N3O2S2/c1-4-11-7-5-6-9-12-13-10(16-9)8(2)17(3,14)15/h8,11H,4-7H2,1-3H3 |
| InChIKey | RHXRTBHUOSPTTF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|