C13H17NO2 — CID 104523498
2,2,6,8-tetramethyl-3,5-dihydro-1,5-benzoxazepin-4-one (PubChem CID 104523498) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2,2,6,8-tetramethyl-3,5-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 2,2,6,8-tetramethyl-3,5-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 104523498 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2,2,6,8-tetramethyl-3,5-dihydro-1,5-benzoxazepin-4-one |
| SMILES | Cc1cc(C)c2c(c1)OC(C)(C)CC(=O)N2 |
| InChI | InChI=1S/C13H17NO2/c1-8-5-9(2)12-10(6-8)16-13(3,4)7-11(15)14-12/h5-6H,7H2,1-4H3,(H,14,15) |
| InChIKey | YGIIVSKQXSFCQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |