C17H15ClN2O — CID 104524433
4-(3-chloroanilino)-3-methyl-2,3-dihydrochromene-4-carbonitrile (PubChem CID 104524433) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-(3-chloroanilino)-3-methyl-2,3-dihydrochromene-4-carbonitrile.
| Compound Name | 4-(3-chloroanilino)-3-methyl-2,3-dihydrochromene-4-carbonitrile |
|---|---|
| PubChem CID | 104524433 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-(3-chloroanilino)-3-methyl-2,3-dihydrochromene-4-carbonitrile |
| SMILES | CC1COc2ccccc2C1(C#N)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O/c1-12-10-21-16-8-3-2-7-15(16)17(12,11-19)20-14-6-4-5-13(18)9-14/h2-9,12,20H,10H2,1H3 |
| InChIKey | WGEJGCALZOVLPX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |