C16H22ClNO — CID 104530451
N-(2-but-3-enoxyethyl)-3-(4-chlorophenyl)cyclobutan-1-amine (PubChem CID 104530451) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-3-(4-chlorophenyl)cyclobutan-1-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-3-(4-chlorophenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 104530451 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-3-(4-chlorophenyl)cyclobutan-1-amine |
| SMILES | C=CCCOCCNC1CC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H22ClNO/c1-2-3-9-19-10-8-18-16-11-14(12-16)13-4-6-15(17)7-5-13/h2,4-7,14,16,18H,1,3,8-12H2 |
| InChIKey | BWBVULWIHIRLBF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|