C14H20ClNOS — CID 114183564
N-(2-but-3-enoxyethyl)-2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 114183564) has the molecular formula C14H20ClNOS and a molecular weight of 285.84 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(2-but-3-enoxyethyl)-2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 114183564 |
| Molecular Formula | C14H20ClNOS |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | C=CCCOCCNC1CCCc2sc(Cl)cc21 |
| InChI | InChI=1S/C14H20ClNOS/c1-2-3-8-17-9-7-16-12-5-4-6-13-11(12)10-14(15)18-13/h2,10,12,16H,1,3-9H2 |
| InChIKey | HGRULRUHOMNJRU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|